| Identification | |
| Name: | 4H-Pyrido[1,2-a]pyrimidin-4-one,3-(2-chloroethyl)-2-methyl- |
| Synonyms: | 3-(2-Chloroethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one; |
| CAS: | 41078-70-0 |
| EINECS: | 255-207-0 |
| Molecular Formula: | C11H11ClN2O |
| Molecular Weight: | 222.67 |
| InChI: | InChI=1/C11H11ClN2O/c1-8-9(5-6-12)11(15)14-7-3-2-4-10(14)13-8/h2-4,7H,5-6H2,1H3 |
| Molecular Structure: | ![(C11H11ClN2O) 3-(2-Chloroethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one;](https://img.guidechem.com/casimg/41078-70-0.gif) |
| Properties | |
| Density: | 1.28 g/cm3 |
| Refractive index: | 1.611 |
| Appearance: | White powder |
| Specification: |
4H-Pyrido[1,2-a]pyrimidin-4-one,3-(2-chloroethyl)-2-methyl- , its cas register number is 41078-70-0. It also can be called 3-(2-Chloroethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one . 4H-Pyrido[1,2-a]pyrimidin-4-one,3-(2-chloroethyl)-2-methyl- (CAS NO.41078-70-0) is a white Solid. |
| Usage: |
An intermediate in the synthesis of Risperidone |
| Safety Data | |
 |
|
