| Identification | |
| Name: | Cyclohexanamine,N-cyclohexyl-, lithium salt (1:1) |
| Synonyms: | Cyclohexanamine,N-cyclohexyl-, lithium salt (9CI); Dicyclohexylamine, Li deriv. (6CI);Dicyclohexylamine, lithium salt (8CI); Lithium, (dicyclohexylamino)- (7CI);(Dicyclohexylamido)lithium; Lithium dicyclohexylamide; Lithiumdicyclohexylamine; N-Cyclohexylcyclohexanamine lithium salt |
| CAS: | 4111-55-1 |
| EINECS: | 223-894-6 |
| Molecular Formula: | C12H23 N . Li |
| Molecular Weight: | 187.25 |
| InChI: | InChI=1/C12H22N.Li/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h11-12H,1-10H2;/q-1;+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3393 4.2/PG 1 |
| Flash Point: | 96.1°C |
| Boiling Point: | 256.1°Cat760mmHg |
| Density: | g/cm3 |
| Specification: | Safety Statements:16-26-27-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | I |
| Flash Point: | 96.1°C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
C: Corrosive
|
 |
|
