| Identification | |
| Name: | 6-Quinolinecarboxaldehyde |
| Synonyms: | - |
| CAS: | 4113-04-6 |
| Molecular Formula: | C10H7NO |
| Molecular Weight: | 157.17 |
| InChI: | InChI=1/C10H7Cl2N/c11-6-8-5-7-3-1-2-4-9(7)13-10(8)12/h1-5H,6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 151.9 ºC |
| Boiling Point: | 314.3 ºC at 760 mmHg |
| Density: | 1.223 g/cm3 |
| Refractive index: | 1.647 |
| Appearance: | white to light yellow powder |
| Specification: |
6-Quinolinecarbaldehyde , its cas register number is 4113-04-6. It also can be called Quinoline-6-Carbaldehyde ; Quinoline-6-Carboxaldehyde ; 6-Quinolinecarboxaldehyde .It is a white to light yellow powder. |
| Flash Point: | 151.9 ºC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
