Identification |
Name: | 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, homopolymer, compd. with dimethyl sulfate |
Synonyms: | 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, homopolymer, compd. with dimethyl sulfate |
CAS: | 41178-11-4 |
Molecular Formula: | C10H21NO6S |
Molecular Weight: | 0 |
InChI: | InChI=1/C8H15NO2.C2H6O4S/c1-7(2)8(10)11-6-5-9(3)4;1-5-7(3,4)6-2/h1,5-6H2,2-4H3;1-2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 70.6°C |
Boiling Point: | 187°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 70.6°C |
Safety Data |
|
|