| Identification | |
| Name: | Piperazine,1-(3-methylphenyl)- |
| Synonyms: | 1-(3-Methylphenyl)piperazine;1-(3-Tolyl)piperazine;1-(m-Methylphenyl)piperazine;1-m-Tolylpiperazine;4-(3-Methylphenyl)piperazine;N-(3-Methylphenyl)piperazine;N-(3-Tolyl)piperazine;N-m-Tolylpiperazine;NSC 150848;NSC 184825; |
| CAS: | 41186-03-2 |
| EINECS: | 255-251-0 |
| Molecular Formula: | C11H16N2 |
| Molecular Weight: | 176.26 |
| InChI: | InChI=1/C11H16N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.012 g/cm3 |
| Refractive index: | 1.5755-1.5785 |
| Appearance: | clear colorless to yellow viscous liquid |
| Specification: |
piperazine, 1-(3-methylphenyl)- , with CAS number of 41186-03-2, can be called 1-(3-Methylphenyl)piperazine ; 1-(3-Methylphenyl)piperazine 98% ; 1-(m-tolyl)piperazine dihydrochloride ; 1-(m-tolyl)piperazine ; 1-m-Tolyl-piperazine . It is a clear colorless to yellow viscous liquid. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
