Benzenemethanamine,2,3,4-trimethoxy- (41219-16-3)

The 2,3,4-Trimethoxybenzylamine, its cas register number is 41219-16-3. It also can be called as Benzenemethanamine,2,3,4-trimethoxy- and the IUPAC name about this chemical is (2,3,4-Trimethoxyphenyl)methanamine. It belongs to the following product categories, such as Anilines, Aromatic Amines and Nitro Compounds.

Physical properties about 2,3,4-Trimethoxybenzylamine are: (1)#H bond acceptors: 4; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 5; (4)Polar Surface Area: 30.93Ų; (5)Index of Refraction: 1.515; (6)Molar Refractivity: 54.74 cm³; (7)Molar Volume: 181.4 cm³; (8)Polarizability: 21.7x10^-24cm³; (9)Surface Tension: 35.5 dyne/cm; (10)Enthalpy of Vaporization: 52.52 kJ/mol; (11)Vapour Pressure: 0.00269 mmHg at 25°C

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=C(C(=C(C=C1)CN)OC)OC
(2)InChI: InChI=1S/C10H15NO3/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5H,6,11H2,1-3H3
(3)InChIKey: QWZMCOACPDTUIO-UHFFFAOYSA-N