| Identification | |
| Name: | Benzenamine,4-(4-methylphenoxy)- |
| Synonyms: | 4-(4-Methylphenoxy)aniline;4-(4-Tolyloxy)aniline;4-(p-Tolyloxy)phenylamine;4-Amino-4'-methyldiphenylether;4-Aminophenyl 4-methylphenyl ether;4-[(4-Methylphenyl)oxy]aniline;NSC509659;p-(p-Tolyloxy)aniline; |
| CAS: | 41295-20-9 |
| EINECS: | 255-298-7 |
| Molecular Formula: | C13H13NO |
| Molecular Weight: | 199.25 |
| InChI: | InChI=1/C13H13NO/c1-10-2-6-12(7-3-10)15-13-8-4-11(14)5-9-13/h2-9H,14H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 122°C |
| Flash Point: | 160.4°C |
| Boiling Point: | 333.1°Cat760mmHg |
| Density: | 1.115g/cm3 |
| Refractive index: | 1.608 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 160.4°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
