| Identification | |
| Name: | 1H-Indole-3-ethanol,7-ethyl- |
| Synonyms: | 2-(7-Ethyl-1H-indol-3-yl)-ethanol;3-(2-Hydroxyethyl)-7-ethylindole;7-Ethyl-1H-indole-3-ethanol;7-Ethyl-3-indoleethanol;RAK 801; |
| CAS: | 41340-36-7 |
| EINECS: | 431-020-1 |
| Molecular Formula: | C12H15NO |
| Molecular Weight: | 189.25 |
| InChI: | InChI=1/C12H15NO/c1-2-12-7-4-3-5-11(12)13-9-10(12)6-8-14/h3-5,7,9,14H,2,6,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 188.1°C |
| Boiling Point: | 310.4°C at 760 mmHg |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.564 |
| Specification: | Pale Beige Solid usageEng:Key intermediate in the preparation of the non-steroidal anti-inflammatory drug Etodolac. Safety Statements:2-36/37/39-61 2:Keep out of the reach of children 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 188.1°C |
| Storage Temperature: | Refrigerator |
| Usage: | Key intermediate in the preparation of the non-steroidal anti-inflammatory drug Etodolac. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
