Identification |
Name: | 27554-26-3 |
Synonyms: | bis(6-methylheptyl) benzene-1,2-dicarboxylate |
CAS: | 41375-90-0 |
Molecular Formula: | C24H38O4 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C24H38O4/c1-19(2)13-7-5-11-17-27-23(25)21-15-9-10-16-22(21)24(26)28-18-12-6-8-14-20(3)4/h9-10,15-16,19-20H,5-8,11-14,17-18H2,1-4H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | -4 deg C /From Table/ |
Flash Point: | 204.5°C |
Boiling Point: | 384.9°Cat760mmHg |
Density: | 0.983g/cm3 |
Solubility: | ... compatible with vinyl chloride resins and some cellulosic resins In water, 9.0X10-2 mg/L at 25 deg C |
Flash Point: | 204.5°C |
Color: | Nearly colorless, viscous liquid |
Safety Data |
|
 |