| Identification | |
| Name: | Benzoic acid,3,5-dihydroxy-, ethyl ester |
| Synonyms: | a-Resorcylic acid, ethyl ester(6CI,7CI,8CI);Ethyl 3,5-dihydroxybenzoate; |
| CAS: | 4142-98-7 |
| Molecular Formula: | C18H22O9 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C9H10O4/c1-2-13-9(12)6-3-7(10)5-8(11)4-6/h3-5,10-11H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 127-130 °C(lit.) |
| Flash Point: | 146.1°C |
| Boiling Point: | 356.2°C at 760 mmHg |
| Density: | 1.294g/cm3 |
| Refractive index: | 1.573 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 146.1°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
