| Identification | |
| Name: | Propanoic acid, 3-bromo-2-(bromomethyl)- |
| Synonyms: | 2,2-Bis(bromomethyl)acetic acid;3-Bromo-2-(bromomethyl)propanoic acid;NSC 259720;b,b'-Dibromoisobutyric acid; |
| CAS: | 41459-42-1 |
| Molecular Formula: | C4H6Br2O2 |
| Molecular Weight: | 245.9 |
| InChI: | InChI=1/C4H6Br2O2/c5-1-3(2-6)4(7)8/h3H,1-2H2,(H,7,8)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Flash Point: | 127.2 ºC |
| Boiling Point: | 286.7 ºC at 760 mmHg |
| Density: | 2.121g/cm3 |
| Appearance: | off-white to brown crystalline powder |
| Specification: |
Propanoic acid, 3-bromo-2-(bromomethyl)- , its cas register number is 41459-42-1. It also can be called 3-Bromo-2-(bromomethyl)propionic acid ; Bis(bromomethyl)acetic acid .It is a off-white to brown crystalline powder. |
| Packinggroup: | III |
| Flash Point: | 127.2 ºC |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
