Identification |
Name: | 3(2H)-Furanone,4-(acetyloxy)-2,5-dimethyl- |
Synonyms: | 3(2H)-Furanone,4-hydroxy-2,5-dimethyl-, acetate (7CI,8CI);4-Acetoxy-2,5-dimethyl-3(2H)furanone;2,5-Dimethyl-4-oxo-4,5-dihydro-3-furanyl acetate;Caramel acetate; |
CAS: | 4166-20-5 |
Molecular Formula: | C8H10O4 |
Molecular Weight: | 170.1626 |
InChI: | InChI=1S/C8H10O4/c1-4-7(10)8(5(2)11-4)12-6(3)9/h4H,1-3H3 |
Molecular Structure: |
|
Properties |
Density: | 1.16 |
Refractive index: | 1.477-1.482 |
Water Solubility: | Slightly soluble in water |
Solubility: | Slightly soluble in water |
Appearance: | Colourless to pale yellow liquid; Faint caramel aroma |
Specification: | Colorless to light yellow liqui Safety Statements:36-24/25 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|