| Identification | |
| Name: | 2-Thiazolamine,5-chloro- |
| Synonyms: | 2-Amino-5-chlorothiazole;5-Chloro-1,3-thiazol-2-amine; 5-Chloro-2-aminothiazole;5-Chloro-2-thiazolamine; 5-Chlorothiazol-2-ylamine; NSC 86106 |
| CAS: | 41663-73-4 |
| Molecular Formula: | C3H3 Cl N2 S |
| Molecular Weight: | 134.59 |
| InChI: | InChI=1/C3H3ClN2S/c4-2-1-6-3(5)7-2/h1H,(H2,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 111.3°C |
| Boiling Point: | 260.5°Cat760mmHg |
| Density: | 1.558g/cm3 |
| Refractive index: | 1.659 |
| Specification: |
2-Amino-5-chlorothiazole with cas registry number of 41663-73-4 is also known as 2-Thiazolamine, 5-chloro- ; 2-Thiazolamine, 5-chloro- (9CI) ; Thiazole, 2-amino-5-chloro- ; 4-27-00-04673 (Beilstein Handbook Reference) ; NSC 86106 . |
| Flash Point: | 111.3°C |
| Safety Data | |
 |
|
