| Identification | |
| Name: | Phosphine, trihexyl- |
| Synonyms: | Tri-n-hexylphosphine;Trihexylphosphine; |
| CAS: | 4168-73-4 |
| EINECS: | 224-025-3 |
| Molecular Formula: | C18H39P |
| Molecular Weight: | 286.476 |
| InChI: | InChI=1/C18H39P/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0,83 g/cm3 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
