Identification |
Name: | Phosphine, trihexyl- |
Synonyms: | Tri-n-hexylphosphine;Trihexylphosphine; |
CAS: | 4168-73-4 |
EINECS: | 224-025-3 |
Molecular Formula: | C18H39P |
Molecular Weight: | 286.476 |
InChI: | InChI=1/C18H39P/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Density: | 0,83 g/cm3 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
|
 |