| Identification | |
| Name: | 1H-Pyrazole-4-carboxylicacid, 3-amino- |
| Synonyms: | 3-Amino-1H-pyrazole-4-carboxylicacid;3-Amino-4-carboxypyrazole;NSC 89246; |
| CAS: | 41680-34-6 |
| EINECS: | 255-493-7 |
| Molecular Formula: | C4H5N3O2 |
| Molecular Weight: | 127.10 |
| InChI: | InChI=1/C4H5N3O2/c5-3-2(4(8)9)1-6-7-3/h1H,(H,8,9)(H3,5,6,7)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 121-126 ºC |
| Flash Point: | 257.8°C |
| Boiling Point: | 502.7°Cat760mmHg |
| Density: | 1.677g/cm3 |
| Appearance: | Almost white to beige crystalline powder |
| Specification: | Almost white to beige crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 257.8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
