Identification |
Name: | Pentanamide,2-ethyl-3-methyl- |
Synonyms: | Valeramide,2-ethyl-3-methyl- (6CI,7CI,8CI); 2-Ethyl-3-methylvaleramide; Axiquel; McN X181; NSC 32363; NSC 34092; Nirvanil; Valmethamide; Valnoctamide |
CAS: | 4171-13-5 |
EINECS: | 224-033-7 |
Molecular Formula: | C8H17 N O |
Molecular Weight: | 143.26 |
InChI: | InChI=1/C8H17NO/c1-4-6(3)7(5-2)8(9)10/h6-7H,4-5H2,1-3H3,(H2,9,10) |
Molecular Structure: |
 |
Properties |
Melting Point: | 113.5-1140C |
Flash Point: | 119.8°C |
Boiling Point: | 274.4°Cat760mmHg |
Density: | 0.883g/cm3 |
Refractive index: | 1.438 |
Specification: |
2-Ethyl-3-methylpentanamide ,its cas register number is 4171-13-5. It also can be called McN-X 181 ; Pentanamide, 2-ethyl-3-methyl- ; and a-Ethyl-b-methylvaleramide .
|
Flash Point: | 119.8°C |
Storage Temperature: | Refrigerator |
Usage: |
2-Ethyl-3-methylpentanamide (CAS NO.4171-13-5) can be used for isomer of Valpromide.
|
Safety Data |
|
 |