Identification |
Name: | Cyclohexaneacetonitrile,1-cyano- |
Synonyms: | 1-Cyanocyclohexaneacetonitrile;1-Cyanomethyl-1-cyclohexanenitrile; |
CAS: | 4172-99-0 |
Molecular Formula: | C9H12N2 |
Molecular Weight: | 148.2 |
InChI: | InChI=1/C9H12N2/c10-7-6-9(8-11)4-2-1-3-5-9/h1-6H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 154.27°C |
Boiling Point: | 319.74°C at 760 mmHg |
Density: | 1.009g/cm3 |
Refractive index: | 1.478 |
Appearance: | White to Off-White Solid |
Specification: | White to Off-White Solid usageEng:An intermediate in the synthesis of Gabapentin |
Flash Point: | 154.27°C |
Usage: | An intermediate in the synthesis of Gabapentin |
Safety Data |
|
 |