| Identification | |
| Name: | Thiazole, 2,5-dimethyl- |
| Synonyms: | 2,5-Dimethylthiazole |
| CAS: | 4175-66-0 |
| Molecular Formula: | C5H7 N S |
| Molecular Weight: | 113.18 |
| InChI: | InChI=1/C5H7NS/c1-4-3-6-5(2)7-4/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.081 g/cm3 |
| Refractive index: | 1.53 |
| Water Solubility: | Soluble in non-polar solvents; slightly soluble in water |
| Solubility: | Soluble in non-polar solvents; slightly soluble in water |
| Appearance: | Yellow liquid; Cooked, brown and roasted nutty aroma |
| Specification: |
The extinguishing agent of 2,5-Dimethylthiazole (CAS NO.4175-66-0) are dry powder, foam, sand, carbon dioxide, water mist. |
| Safety Data | |
 |
|
