| Identification | |
| Name: | 2,4-Dibromothiazole |
| Synonyms: | 2,4-dibromo-1,3-thiazole;2,4-Dibromo-thiazole; |
| CAS: | 4175-77-3 |
| Molecular Formula: | C3HBr2NS |
| Molecular Weight: | 242.92 |
| InChI: | InChI=1S/C3HBr2NS/c4-2-1-7-3(5)6-2/h1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.324 g/cm3 |
| Refractive index: | 1.649? |
| Appearance: | Off-white crystalline powder |
| Specification: |
?2,4-Dibromothiazole , with CAS number of 4175-77-3, can be called 2,4-dibromo-1,3-thiazole ; 2,4-Dibromo-thiazole ; 2,4-Dibrmothiazole ; (R)-2-Methyl-Pyrrolidine . It is an?off-white crystalline powder.?2,4-Dibromothiazole (CAS NO.4175-77-3) is used as intermediates in organic synthesis. |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
