| Identification | |
| Name: | 1H-1,2,4-Triazole,1,1'-carbonylbis- |
| Synonyms: | 1,1'-Carbonylbis(1,2,4-triazole);1,1'-Carbonyldi(1,2,4-triazole); Carbonyldi(1,2,4-triazole) |
| CAS: | 41864-22-6 |
| Molecular Formula: | C5H4 N6 O |
| Molecular Weight: | 164.12 |
| InChI: | InChI=1/C5H4N6O/c12-5(10-3-6-1-8-10)11-4-7-2-9-11/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 145-150 ºC |
| Flash Point: | 213.3°C |
| Boiling Point: | 429.1°C at 760 mmHg |
| Density: | 1.75g/cm3 |
| Refractive index: | 1.838 |
| Specification: |
1H-1,2,4-Triazole,1,1'-carbonylbis , its cas register number is 41864-22-6. It also can be called 1,1'-Carbonyl-di(1,2,4-triazole) ; and CDT . |
| Flash Point: | 213.3°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
