| Identification | |
| Name: | Benzene,1-(chlorophenylmethyl)-2-methyl- |
| Synonyms: | Methane,chlorophenyl-o-tolyl- (6CI,7CI); |
| CAS: | 41870-52-4 |
| EINECS: | 431-450-1 |
| Molecular Formula: | C14H13Cl |
| Molecular Weight: | 216.71 |
| InChI: | InChI=1/C14H13Cl/c1-11-7-5-6-10-13(11)14(15)12-8-3-2-4-9-12/h2-10,14H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.098g/cm3 |
| Refractive index: | 1.576 |
| Specification: |
The 2-Methylbenzhydryl chloride is an organic compound with the formula C14H13Cl. The systematic name of this chemical is 1-[chloro(phenyl)methyl]-2-methylbenzene. With the CAS registry number 41870-52-4, it is also named as benzene, 1-(chlorophenylmethyl)-2-methyl-. Additionally, this chemical must be avoided direct sunshine. The other characteristics of this product can be summarized as: (1)ACD/LogP: 4.07; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4; (4)ACD/LogD (pH 7.4): 4; (5)ACD/BCF (pH 5.5): 1341; (6)ACD/BCF (pH 7.4): 1341; (7)ACD/KOC (pH 5.5): 6030; (8)ACD/KOC (pH 7.4): 6030; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 0 ?2; (13)Index of Refraction: 1.576; (14)Molar Refractivity: 65.244 cm3; (15)Molar Volume: 197.243 cm3; (16)Polarizability: 25.865×10-24 cm3; (17)Surface Tension: 39.051 dyne/cm ; (18)Flash Point: 138.551 °C; (19)Enthalpy of Vaporization: 53.285 kJ/mol; (20)Boiling Point: 313.859 °C at 760 mmHg; (21)Vapour Pressure: 0.001 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
