| Identification |
| Name: | 3-(2,3-dichlorophenoxy)propyl-(2-hydroxyethyl)azanium |
| Synonyms: | 2-[[3-(2,3-DICHLOROPHENOXY)PROPYL]AMINO]ETHANOL HYDROCHLORIDE;2,3-DCPE HYDROCHLORIDE;2,3-DCPEHCl |
| CAS: | 418788-90-6 |
| Molecular Formula: | C11H16Cl2NO2+ |
| Molecular Weight: | 300.61 |
| InChI: | InChI=1/C11H15Cl2NO2/c12-9-3-1-4-10(11(9)13)16-8-2-5-14-6-7-15/h1,3-4,14-15H,2,5-8H2/p+1 |
| Molecular Structure: |
![(C11H16Cl2NO2+) 2-[[3-(2,3-DICHLOROPHENOXY)PROPYL]AMINO]ETHANOL HYDROCHLORIDE;2,3-DCPE HYDROCHLORIDE;2,3-DCPEHCl](https://img.guidechem.com/cas/gif/418788-90-6.gif) |
| Properties |
| Flash Point: | 197.5°C |
| Boiling Point: | 402.9°Cat760mmHg |
| Density: | g/cm3 |
| Biological Activity: | Selectively induces apoptosis and downregulates Bcl-XL protein expression in various human cancer cells versus normal cells in vitro . IC 50 values are 0.89 and 12.6 μ M for LoVo human colon cancer cell line and normal human fibroblasts respectively. Induces p21 expression and S-phase arrest in cancer cells via ERK-mediated pathways. |
| Flash Point: | 197.5°C |
| Safety Data |
| |
 |
