| Identification |
| Name: | 2-But-enedioic acid(Z)-, monobutyl ester, polymer with chloro-ethene and ethenylacetate |
| Synonyms: | 2-butenedioic acid (z)-, monobutyl ester, polymer with chloroethene and ethenyl;2-But-enedioic acid(Z)-, monobutyl ester, polymer with chloro-ethene and ethenylacetate |
| CAS: | 41934-30-9 |
| Molecular Formula: | C14H21ClO6 |
| Molecular Weight: | 320.76594 |
| InChI: | InChI=1S/C8H12O4.C4H6O2.C2H3Cl/c1-2-3-6-12-8(11)5-4-7(9)10;1-3-6-4(2)5;1-2-3/h4-5H,2-3,6H2,1H3,(H,9,10);3H,1H2,2H3;2H,1H2/b5-4-;; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 113.9°C |
| Boiling Point: | 289.1°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 113.9°C |
| Safety Data |
| |
 |
