| Identification | |
| Name: | 3,5-Dimethyl-4-hydroxybenzonitrile |
| Synonyms: | 2,6-Dimethyl-4-cyanophenol;4-Cyano-2,6-dimethylphenol;4-Hydroxy-3,5-dimethylbenzonitrile; |
| CAS: | 4198-90-7 |
| Molecular Formula: | C9H9NO |
| Molecular Weight: | 147.17386 |
| InChI: | InChI=1S/C9H9NO/c1-6-3-8(5-10)4-7(2)9(6)11/h3-4,11H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.13 g/cm3 |
| Refractive index: | 1.563 |
| Water Solubility: | soluble in methanol, chloroform |
| Solubility: | soluble in methanol, chloroform |
| Appearance: | Light brown crystalline. |
| Specification: |
3,5-Dimethyl-4-hydroxybenzonitrile , with CAS number of 4198-90-7, can be called 2,6-Dimethyl-4-cyanophenol ; 4-Cyano-2,6-dimethylphenol ; 4-Hydroxy-3,5-dimethylbenzonitrile . It is a white to beige crystalline powder. |
| Storage Temperature: | Refrigerator |
| Usage: | Intermediate in the preparation of HIV replication inhibitors. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xn:Harmful
|
 |
|
