| Identification | |
| Name: | 3-Isoquinolinecarboxylicacid, 1,2,3,4-tetrahydro-, hydrochloride (1:1) |
| Synonyms: | 3-Isoquinolinecarboxylicacid, 1,2,3,4-tetrahydro-, hydrochloride (6CI,9CI); 1,2,3,4-Tetrahydro-3-isoquinolinecarboxylicacid hydrochloride; 3-Carboxy-1,2,3,4-tetrahydroisoquinoline hydrochloride |
| CAS: | 41994-51-8 |
| EINECS: | 255-610-1 |
| Molecular Formula: | C10H11 N O2 . Cl H |
| Molecular Weight: | 177.2 |
| InChI: | InChI=1/C10H11NO2.ClH/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >300 °C(lit.) |
| Flash Point: | 178.8°C |
| Boiling Point: | 372°Cat760mmHg |
| Density: | 1.225g/cm3 |
| Specification: | white to off-white crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 178.8°C |
| Safety Data | |
 |
|
