| Identification | |
| Name: | 2-(3,4-Dichlorophenyl)-2-oxoethylamine hydrochloride |
| Synonyms: | 2-Amino-1-(3,4-dichlorophenyl)ethanone hydrochloride (1:1);ethanone, 2-amino-1-(3,4-dichlorophenyl)-, hydrochloride (1:1);2-Amino-1-(3,4-dichlorophenyl)ethanone hydrochloride; |
| CAS: | 41995-19-1 |
| Molecular Formula: | C8H7Cl2NO.HCl |
| Molecular Weight: | 240.51 |
| InChI: | InChI=1/C8H7Cl2NO.ClH/c9-6-2-1-5(3-7(6)10)8(12)4-11;/h1-3H,4,11H2;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The 2-(3,4-Dichlorophenyl)-2-oxoethylamine hydrochloride with the cas number 41995-19-1, is also called 2-Amino-1-(3,4-dichlorophenyl)ethanone hydrochloride .The product can be supplied by the following suppliers:(1)SuZhou Hanker PharmaChem Technology Co. Ltd.; (2)PSN Chemical Technology Co., Ltd.. The properties of the chemical are: (1)ACD/LogP: 2.22 ; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 2 ; (4)#H bond donors: 2 ; (5)#Freely Rotating Bonds: 3 ; (6)Polar Surface Area: 17.07 Å2 ; (7)Enthalpy of Vaporization: 63.11 kJ/mol ; (8)Vapour Pressure: 6.83×10-6 mmHg at 25°C . You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
