| Identification | |
| Name: | Propane, 2-fluoro- |
| Synonyms: | 2-Fluoropropane;Isopropyl fluoride;R 281ea |
| CAS: | 420-26-8 |
| Molecular Formula: | C3H7 F |
| Molecular Weight: | 62.09 |
| InChI: | InChI=1/C3H7F/c1-3(2)4/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3161 |
| Melting Point: | -133,4°C |
| Boiling Point: | -10°C |
| Density: | 0.969 |
| Refractive index: | 1.3282 |
| Specification: | Safety Statements:9-16-23-33 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 33:Take precautionary measures against static discharges |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
