| Identification | |
| Name: | Trimethyloxonium tetrafluoroborate |
| Synonyms: | Oxonium, trimethyl-, tetrafluoroborate(1-);boron(+3) cation; trimethyloxidanium; tetrafluoride;Oxonium, trimethyl-, tetrafluoroborate (1-);Trimethyloxonium fluoroborate;Trimethyloxonium tetrafluoroborate (1-); |
| CAS: | 420-37-1 |
| EINECS: | 206-994-4 |
| Molecular Formula: | C3H9BF4O |
| Molecular Weight: | 147.9061 |
| InChI: | InChI=1/C3H9O.B.4FH/c1-4(2)3;;;;;/h1-3H3;;4*1H/q+1;+3;;;;/p-4 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Melting Point: | 200 °C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | white to off-white crystals |
| Specification: | white to off-white crystals Safety Statements:26-36/37/39-43-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 43:In case of fire, use ... (indicate in the space the precise type of fire-fighting equipment. If water increases the risk add - Never use water) 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
