| Identification | |
| Name: | BROMOCONDURITOL |
| Synonyms: | 6-BROMO-3,4,5-TRIHYDROXYCYCLOHEX-1-ENE;6-BROMO-4-CYCLOHEXENE-1,2,3-TRIOL;BROMOCONDURITOL;Bromoconduritol (Mixture of Isomers);6-BROMO-4-CYCLOHEXENE-1,2,3-TRIOL MIXED ISOMERS;6-bromoconduritol;6-bromocyclohex-4-ene-1,2,3-triol |
| CAS: | 42014-74-4 |
| Molecular Formula: | C6H9BrO3 |
| Molecular Weight: | 209.04 |
| InChI: | InChI=1/C6H9BrO3/c7-3-1-2-4(8)6(10)5(3)9/h1-6,8-10H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 130.1°C |
| Boiling Point: | 291.6°C at 760 mmHg |
| Density: | 1.989g/cm3 |
| Refractive index: | 1.682 |
| Flash Point: | 130.1°C |
| Storage Temperature: | 2-8°C |
| Usage: | Bromoconduritol selectively inhibits mammalian alpha-glucosidase 2 (Glc2/Glc1 glucosidase in the glycoprotein processing pathway), yeast alpha-glucosidase, and some beta-glucosidases. It does not inhibit mammalian alpha-glucosidase 1 (Glc3-glucosidase) |
| Safety Data | |
 |
|
