| Identification | |
| Name: | Butanethioic acid,2-methyl-, S-methyl ester |
| Synonyms: | S-Methyl2-methylbutanethioate |
| CAS: | 42075-45-6 |
| EINECS: | 255-648-9 |
| Molecular Formula: | C6H12 O S |
| Molecular Weight: | 132.22388 |
| InChI: | InChI=1S/C6H12OS/c1-4-5(2)6(7)8-3/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.95 g/cm3 |
| Refractive index: | 1.456 |
| Water Solubility: | insoluble in water; soluble in fats and alcohols |
| Solubility: | insoluble in water; soluble in fats and alcohols |
| Appearance: | Colorless to Slight yellow liquild |
| Specification: |
S-Methyl 2-methylthiobutyrate (CAS No.42075-45-6), its synonyms are Butanethioic acid, 2-methyl-, S-methyl ester ; Methyl 2-methylthiobutyrate ; Methyl 2-methyl(thiobutyrate) ; Methylthiol 2-methylbutyrate . |
| Safety Data | |
 |
|
