| Identification | |
| Name: | 1,6-Octadiene,7-methyl- |
| Synonyms: | 7-Methyl-1,6-octadiene |
| CAS: | 42152-47-6 |
| EINECS: | 404-210-7 |
| Molecular Formula: | C9H16 |
| Molecular Weight: | 124.2233 |
| InChI: | InChI=1/C9H16/c1-4-5-6-7-8-9(2)3/h4,8H,1,5-7H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 3/PG 3 |
| Flash Point: | 29.9°C |
| Boiling Point: | 145.7°Cat760mmHg |
| Density: | 0.75g/cm3 |
| Refractive index: | n20/D 1.436(lit.) |
| Specification: | Safety Statements:60-61 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Flash Point: | 29.9°C |
| Safety Data | |
 |
|
