| Identification | |
| Name: | 1-Naphthalenemethanol, a-methyl-, (aR)- |
| Synonyms: | 1-Naphthalenemethanol,a-methyl-, (R)-;(+)-1-(1-Naphthalene)ethanol;(+)-1-(1-Naphthyl)ethanol;(R)-(+)-1-(1-Naphthyl)ethanol;(R)-(+)-a-Methyl-1-naphthalenemethanol;(R)-1-(1-Naphthyl)-1-hydroxyethane;(R)-1-(1-Naphthyl)ethanol;(R)-1-(Naphthalen-1-yl)ethanol;(R)-1-(a-Naphthyl)ethanol;(R)-a-Methyl-1-naphthalenemethanol;(aR)-a-Methyl-1-naphthalenemethanol;R-(+)-1-Naphthyl-1-ethanol; |
| CAS: | 42177-25-3 |
| Molecular Formula: | C12H12O |
| Molecular Weight: | 172.22 |
| InChI: | InChI=1/C12H12O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9,13H,1H3/t9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 47-49 °C(lit.) |
| Flash Point: | 145.4°C |
| Boiling Point: | 316°Cat760mmHg |
| Density: | 1.113g/cm3 |
| Refractive index: | 1.632 |
| Alpha: | 78 º (C=1 IN MEOH) |
| Specification: |
The CAS register number of (R)-(+)-1-(1-Naphthyl)ethanol is 42177-25-3. It also can be called as 1-Naphthalenemethanol, a-methyl-, (aR)- and the IUPAC name about this chemical is 1-naphthalen-1-ylethanol. The molecular formula about this chemical is C12H12O and molecular weight is 172.22. When you are using it, please do not breathe dust and avoid contact with skin and eyes. Physical properties about (R)-(+)-1-(1-Naphthyl)ethanol are: (1)ACD/LogP: 2.61; (2)#H bond acceptors: 1; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 2; (5)Polar Surface Area: 9.23Å2; (6)Index of Refraction: 1.632; (7)Molar Refractivity: 55.18 cm3; (8)Molar Volume: 154.6 cm3; (9)Polarizability: 21.87x10-24cm3; (10)Surface Tension: 46.1 dyne/cm; (11)Enthalpy of Vaporization: 58.84 kJ/mol; (12)Boiling Point: 316 °C at 760 mmHg; (13)Vapour Pressure: 0.000177 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 145.4°C |
| Safety Data | |
 |
|
