| Identification | |
| Name: | 3-Chloro-3-methyldiazirine |
| Synonyms: | 3-Chloro-3-methyl-3H-diazirene;3H-diazirine, 3-chloro-3-methyl-;3-Methyl-3-chlorodiazirene;3-Methyl-3-chlorodiazirine |
| CAS: | 4222-21-3 |
| Molecular Formula: | C2H3ClN2 |
| Molecular Weight: | 90.5116 |
| InChI: | InChI=1/C2H3ClN2/c1-2(3)4-5-2/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 45.8°C at 760 mmHg |
| Density: | 1.54g/cm3 |
| Refractive index: | 1.607 |
| Specification: |
3-Chloro-3-methyldiazirine (CAS NO.4222-21-3) is also called 3-Methyl-3-chlorodiazirine . 3-Chloro-3-methyldiazirine (CAS NO.4222-21-3) is instability. It will decomposit of an explosion at room temperature. It will produce toxic chloride and nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Safety Data | |
 |
|
