| Identification | |
| Name: | 2-Propen-1-one,3-(4-methylphenyl)-1-phenyl- |
| Synonyms: | Chalcone,4-methyl- (6CI,7CI,8CI); (4-Methylbenzylidene)acetophenone;1-Phenyl-3-(4-methylphenyl)-2-propenone; 1-Phenyl-3-(4-tolyl)-2-propen-1-one;3-(4-Methylphenyl)-1-phenyl-2-propen-1-one;3-(p-Methylphenyl)-1-phenyl-2-propen-1-one; 4-Methylchalcone; 4-Methylstyrylphenyl ketone; NSC 39793; Phenyl p-methylstyryl ketone; p-Methylchalcone;p-Methylstyryl phenyl ketone |
| CAS: | 4224-87-7 |
| Molecular Formula: | C16H14 O |
| Molecular Weight: | 222.30 |
| InChI: | InChI=1S/C16H14O/c1-13-7-9-14(10-8-13)11-12-16(17)15-5-3-2-4-6-15/h2-12H,1H3/b12-11+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 157.7°C |
| Boiling Point: | 363.6°Cat760mmHg |
| Density: | 1.078g/cm3 |
| Specification: |
4-Hydroxy-N,N-dimethyltryptamine (520-53-6) also can be called Chalcone, 4-methyl- ; 2-Propen-1-one, 3- (4-methylphenyl)-1-phenyl- ; 3-(4-methylphenyl)-1-phenylprop-2-en-1-one ; 3-(4-Methyl-phenyl)-1-phenyl-propenone ; (4-Methylbenzylidene)acetophenone ; 2-Propen-1-one, 3-(4-methylphenyl)-1-phenyl- and 3-(4-Methylphenyl)-1-phenyl-2-propen-1-one . |
| Flash Point: | 157.7°C |
| Safety Data | |
 |
|
