| Identification | |
| Name: | (R)-1-methyl-2-(aminoethyl)pyrrolidine |
| Synonyms: | 2-Pyrrolidineethanamine,1-methyl-,(2R)-(9CI) |
| CAS: | 422545-96-8 |
| Molecular Formula: | C7H16N2 |
| Molecular Weight: | 128.22 |
| InChI: | InChI=1/C7H16N2/c1-9-6-2-3-7(9)4-5-8/h7H,2-6,8H2,1H3/t7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 65°C |
| Boiling Point: | 152.7°C at 760 mmHg |
| Density: | 0.909 |
| Refractive index: | 1.473 |
| Specification: |
The cas register number of (2R)-1-Methyl-2-pyrrolidineethanamine is 422545-96-8. It also can be called as 2-pyrrolidineethanamine, 1-methyl-, (2R)- and the Systematic name about this chemical is 2-[(2R)-1-methylpyrrolidin-2-yl]ethanamine. Physical properties about (2R)-1-Methyl-2-pyrrolidineethanamine are: (1)ACD/LogP: 0.13; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 2; (8)#H bond donors: 2; (9)#Freely Rotating Bonds: 3; (10)Polar Surface Area: 29.26Å2; (11)Index of Refraction: 1.473; (12)Molar Refractivity: 39.58 cm3; (13)Molar Volume: 141 cm3; (14)Surface Tension: 31.7 dyne/cm; (15)Density: 0.909 g/cm3; (16)Flash Point: 65 °C; (17)Enthalpy of Vaporization: 38.95 kJ/mol; (18)Boiling Point: 152.7 °C at 760 mmHg; (19)Vapour Pressure: 3.45 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Flash Point: | 65°C |
| Safety Data | |
 |
|
