| Identification | |
| Name: | Benzene, 1,1'-oxybis-,pentachloro deriv. |
| Synonyms: | Pentachlorodiphenylether |
| CAS: | 42279-29-8 |
| Molecular Formula: | C12H5 Cl5 O |
| Molecular Weight: | 342.42 |
| InChI: | InChI=1/C12H5Cl5O/c13-7-8(14)10(16)12(11(17)9(7)15)18-6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 129.3°C |
| Boiling Point: | 364.2°Cat760mmHg |
| Density: | 1.558g/cm3 |
| Refractive index: | 1.619 |
| Specification: |
Pentachloro diphenyl oxide , its cas register number is 42279-29-8. It also can be called Phenyl ether pentachloro ; Pentachloro diphenyl ether ; and Ether, pentachlorophenyl . |
| Flash Point: | 129.3°C |
| Safety Data | |
 |
|
