| Identification | |
| Name: | 3H-1,2,4-Triazol-3-one,1,2-dihydro-1-phenyl- |
| Synonyms: | 1H-1,2,4-Triazol-3-ol,1-phenyl- (7CI); D3-1,2,4-Triazolin-5-one,2-phenyl- (8CI); 1-Phenyl-1,2,4-triazol-3-ol; 1-Phenyl-1,2,4-triazole-3-ol;1-Phenyl-3-hydroxy-1,2,4-triazole; 3-Hydroxy-1-phenyl-1,2,4-triazole;3-Hydroxy-1-phenyl-1H-1,2,4-triazole |
| CAS: | 4231-68-9 |
| EINECS: | 224-187-5 |
| Molecular Formula: | C8H7 N3 O |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C8H7N3O/c12-8-9-6-11(10-8)7-4-2-1-3-5-7/h1-6H,(H,10,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 1.32 g/cmºC |
| Density: | 1.32 g/cm3 |
| Refractive index: | 1.665 |
| Appearance: | White to pale yellow crystal powder. |
| Specification: |
3-Hydroxy-1-phenyl-1,2,4-triazole , its cas register number is 4231-68-9. It also can be called Phenyltriazolol ; 1-Phenyl-2H-1,2,4-triazol-3-one ; and 1-Phenyl-3-hydroxy-1,2,4-triazole . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
