| Identification | |
| Name: | dimethyl benzene-1,4-dicarboxylate; 2,2-dimethylhexanedioic acid; ethylene glycol |
| Synonyms: | AC1O547D;dimethyl benzene-1,4-dicarboxylate; 2,2-dimethylhexanedioic acid; ethane-1,2-diol;1,4-Benzenedicarboxylic acid, 1,4-dimethyl ester, polymer with 1,6-dimethyl hexanedioate and 1,2-ethanediol;1,4-Benzenedicarboxylic acid, dimethyl ester, polymer with dimethyl hexanedioate and 1,2-ethanediol;42342-18-7 |
| CAS: | 42342-18-7 |
| Molecular Formula: | C20H30O10 |
| Molecular Weight: | 430.4462 |
| InChI: | InChI=1/C10H10O4.C8H14O4.C2H6O2/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2;1-8(2,7(11)12)5-3-4-6(9)10;3-1-2-4/h3-6H,1-2H3;3-5H2,1-2H3,(H,9,10)(H,11,12);3-4H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 148°C |
| Boiling Point: | 285°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 148°C |
| Safety Data | |
 |
|
