| Identification | |
| Name: | 2-Cyclopenten-1-one,3-ethyl-2-hydroxy-4-methyl- |
| Synonyms: | 2-Hydroxy-3-ethyl-4-methylcyclopent-2-en-1-one;3-Ethyl-2-hydroxy-4-methyl-cyclopent-2-en-1-one |
| CAS: | 42348-12-9 |
| EINECS: | 255-767-6 |
| Molecular Formula: | C8H12O2 |
| Molecular Weight: | 140.18 |
| InChI: | InChI=1/C8H12O2/c1-3-6-5(2)4-7(9)8(6)10/h5,10H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.086 g/cm3 |
| Refractive index: | 1.507 |
| Water Solubility: | slightly insoluble in water; soluble in fat; miscible with ethanol |
| Solubility: | slightly insoluble in water; soluble in fat; miscible with ethanol |
| Specification: |
4-Methyl-3-ethylcyclopentane-1,2-dione (CAS No.42348-12-9), its synonym is 3-Ethyl-2-hyudroxy-4-methylcyclopent-2-en-1-one . |
| Safety Data | |
 |
|
