| Identification | |
| Name: | 1,5-Benzothiazepin-4(5H)-one,2,3-dihydro-3-hydroxy-2-(4-methoxyphenyl)-, (2S,3S)- |
| Synonyms: | 1,5-Benzothiazepin-4(5H)-one,2,3-dihydro-3-hydroxy-2-(4-methoxyphenyl)-, (2S-cis)-;(2S,3S)-3-Hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4(5H)-one; |
| CAS: | 42399-49-5 |
| EINECS: | 255-799-0 |
| Molecular Formula: | C16H15NO3S |
| Molecular Weight: | 301.36 |
| InChI: | InChI=1/C16H15NO3S/c1-20-11-8-6-10(7-9-11)15-14(18)16(19)17-12-4-2-3-5-13(12)21-15/h2-9,14-15,18H,1H3,(H,17,19)/t14-,15+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 283.7°C |
| Boiling Point: | 545.4°Cat760mmHg |
| Density: | 1.303g/cm3 |
| Refractive index: | 114 ° (C=0.5, MeOH) |
| Alpha: | 112 º (C=0.5 IN MEOH) |
| Appearance: | white to slightly beige powder |
| Specification: |
1,5-Benzothiazepin-4(5H)-one,2,3-dihydro-3-hydroxy-2-(4-methoxyphenyl)-, (2S,3S)- , its cas register number is 42399-49-5. It also can be called 2S-cis)-2,3-Dihydro-3-hydroxy-2-(4-methoxyphenyl)-1,5-benzothiazepin-4(5H)-one . 5-Benzothiazepin-4(5H)-one,2,3-dihydro-3-hydroxy-2-(4-methoxyphenyl)-, (2S,3S)- (CAS NO.42399-49-5) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Flash Point: | 283.7°C |
| Storage Temperature: | Refrigerator |
| Usage: | A key intermediate for Diltiazem (D460620) synthesis. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
