| Identification | |
| Name: | 3-Cyano-6-methyl-2(1H)-pyridinone |
| Synonyms: | - |
| CAS: | 4241-27-4 |
| EINECS: | 224-202-5 |
| Molecular Formula: | C7H6N2O |
| Molecular Weight: | 134.14 |
| InChI: | InChI=1/C7H6N2O/c1-5-2-3-6(4-8)7(10)9-5/h2-3H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.2 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.567 |
| Solubility: | 2.38 g/L (20 ºC) in water |
| Appearance: | SLIGHTLY YELLOW GRANULAR CRYSTALLINE POWDER |
| Specification: |
3-Pyridinecarbonitrile,1,2-dihydro-6-methyl-2-oxo- , its cas register number is 4241-27-4. It also can be called NSC 15124 ; 1,2-Dihydro-6-methyl-2-oxonicotinonitrile ; Nicotinonitrile, 1,2-dihydro-6-methyl-2-oxo- (8CI) . 3-Pyridinecarbonitrile,1,2-dihydro-6-methyl-2-oxo- (CAS NO.4241-27-4) is irritating to eyes, respiratory system and skin. And it's also harmful by inhalation, in contact with skin and if swallowed. So you should wear suitable protective clothing, gloves and eye/face protection. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
