| Identification | |
| Name: | 5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| Synonyms: | Palonosetron Intermediate |
| CAS: | 4242-18-6 |
| Molecular Formula: | C11H12O2 |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C11H12O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7H,1-2,4,6H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.184 g/cm3 |
| Refractive index: | 1.586 |
| Appearance: | White or whitish crystalline powder |
| Specification: |
5,6,7,8-Tetrahydronaphthalene-1-carboxylic acid , with CAS number of 4242-18-6, can be called 5,6,7,8-Tetrahydro-1-naphthalenecarboxylic acid ; 5,6,7,8-tetrahydro-1-naphthoic acid ; 5,6,7,8-tetrahydro-naphthalene-1-carbonyl acid ; 5,6,7,8-tetrahydronaphthalene-1-carboxylic acid ; 5.6.7.8-tetrahydro-1-naphtoic acid ; 5,6,7,8-Tetrahydro-1-Naphthylenecarboxylic Acid;NSC44874;5,6,7,8-tetrahedro-1-naphthoic acid . |
| Safety Data | |
 |
|
