| Identification | |
| Name: | N-Methyl-2-phthalimidoglutarimide |
| Synonyms: | 1-Methyl-3-(1,3-dioxoisoindolin-2-yl)-2,6-piperidinedione;WU-313 |
| CAS: | 42472-93-5 |
| Molecular Formula: | C14H12N2O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H12N2O4/c1-15-11(17)7-6-10(14(15)20)16-12(18)8-4-2-3-5-9(8)13(16)19/h2-5,10H,6-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 232°C |
| Boiling Point: | 477°C at 760 mmHg |
| Density: | 1.457g/cm3 |
| Refractive index: | 1.64 |
| Specification: |
N-Methyl-2-phthalimidoglutarimide , its cas register number is 42472-93-5. It also can be called Glutarimide, N-methyl-2-phthalimido- ; 1H-Isoindole-1,3(2H)-dione, 2-(1-methyl-2,6-dioxo-3-piperidinyl)- (9CI) ; and 2-Phthalimido-N-methyl glutarimide . |
| Flash Point: | 232°C |
| Safety Data | |
 |
|
