| Identification | |
| Name: | 2,2',4'-Trichloroacetophenone |
| Synonyms: | 2-Chloro-1-(2,4-dichlorophenyl)ethanone; alpha,2,4-Trichloroacetophenone; 2,2,4-Trichloroacetophenone; omega,2,4-trichloroacetophenone; chloromethyl 2,4-dichlorophenyl ketone; 2,4-Dichlorophenacyl chloride; 2,2,4-Trichloro Acetophenone; 2,2,4'-trichloro acetophenone |
| CAS: | 4252-78-2 |
| EINECS: | 224-218-2 |
| Molecular Formula: | C8H5Cl3O |
| Molecular Weight: | 223.48 |
| InChI: | InChI=1/C8H5Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Density: | 1,312 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.565 |
| Appearance: | brown crystals. |
| Packinggroup: | III |
| HS Code: | 29147090 |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Sensitive: | Lachrymatory |
| Color: | beige to yellow |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
