| Identification | |
| Name: | Ethanone,1-(1H-indol-2-yl)- |
| Synonyms: | Ketone,indol-2-yl methyl (7CI,8CI);1-(1H-Indol-2-yl)ethanone;2-Acetylindole; |
| CAS: | 4264-35-1 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 159.18456 |
| InChI: | InChI=1/C10H9NO/c1-7(12)10-6-8-4-2-3-5-9(8)11-10/h2-6,11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 163.7°C |
| Boiling Point: | 333.9°C at 760 mmHg |
| Density: | 1.193g/cm3 |
| Refractive index: | 1.648 |
| Specification: | Yellow Crystalline Solid usageEng:A useful intermediate for the synthesis of pharmaceutical actives, intermediates and fine chemicals |
| Flash Point: | 163.7°C |
| Storage Temperature: | Refrigerator |
| Usage: | A useful intermediate for the synthesis of pharmaceutical actives, intermediates and fine chemicals |
| Safety Data | |
 |
|
