| Identification | |
| Name: | 5-Cyano-5H-dibenz[b,f]azepine |
| Synonyms: | 5H-Dibenz[b,f]azepine-5-carbonitrile; |
| CAS: | 42787-75-7 |
| EINECS: | 255-944-8 |
| Molecular Formula: | C15H10N2 |
| Molecular Weight: | 218.25 |
| InChI: | InChI=1/C15H10N2/c16-11-17-14-7-3-1-5-12(14)9-10-13-6-2-4-8-15(13)17/h1-10H |
| Molecular Structure: | ![(C15H10N2) 5H-Dibenz[b,f]azepine-5-carbonitrile;](https://img1.guidechem.com/chem/e/dict/17/42787-75-7.jpg) |
| Properties | |
| Melting Point: | 106-110 °C |
| Flash Point: | 183.3°C |
| Boiling Point: | 410.4°Cat760mmHg |
| Density: | 1.25g/cm3 |
| Specification: |
5H-Dibenz[b,f]azepine-5-carbonitrile, with its' cas number 42787-75-7, is also called 5-Cyano-5H-dibenz[b,f]azepine. In addtion,5H-Dibenz[b,f]azepine-5-carbonitrile is named benzo[b][1]benzazepine-11-carbonitrile by IUPAC. 5-Cyano 5H-dibenz[f,b]azepine (IV) can be used in the synthesis of Oxcarbazepine. With the nitration of 5-cyano 5H-dibenz[f,b]azepine (IV) with NaNO2 in acetic anhydride -acetic acid gives 5-cyano 10-nitro-5H-dibenz[b, f]azepine (V), which is then treated with BrF3 and powdered Fe in hot acetic acid. With this condition, Oxcarbazepine can be produced. |
| Flash Point: | 183.3°C |
| Safety Data | |
 |
|
