| Identification | |
| Name: | Cladribine |
| Synonyms: | 2-Chloro-2-deoxy-beta-adenosine;2-Chloro-6-amino-9-(2-deoxy-beta-D-erythropentofuranosyl)purine;Chlorodeoxyadenosine;RWJ 26251;Adenosine,2-chloro-2'-deoxy-;Leustatin;24757-90-2;2-CdA;2-Chlorodeoxyadenosine;Adenosine, 2-chloro-2-deoxy;Cladribine(Base);Cadribine;Leustatin (TN);Cladribine [USAN:BAN:INN];2-Chloro-2-deoxyadenosine; |
| CAS: | 4291-63-8 |
| EINECS: | 224-427-9 |
| Molecular Formula: | C10H12ClN5O3 |
| Molecular Weight: | 285.69 |
| InChI: | InChI=1/C10H12ClN5O3/c11-10-14-8(12)7-9(15-10)16(3-13-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H2,12,14,15)/t4-,5+,6+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.03g/cm3 |
| Stability: | Store in Freezer |
| Solubility: | Insoluble |
| Appearance: | White Crystalline Solid |
| Specification: |
? Cladribine ,?its cas register number is 4291-63-8. It also can be called?2-CdA ; 2-Chloro-2'-deoxy-beta-adenosine ; 2-Chloro-2'-deoxyadenosine ; 2-Chloro-6-amino-9-(2-deoxy-beta-D-erythropentofuranosyl)purine ; 2-Chlorodeoxyadenosine ; Adenosine, 2-chloro-2'-deoxy- ; Chlorodeoxyadenosine ; Cladarabine ; Cladribine ; HSDB 7564 ; |
| Color: | Crystals from water, softens at 210-215 deg C, solidifies and turns brown ... Also reported as crystals from ethanol |
| Usage: | It is a substituted purine nucleoside with antileukemic activity |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
