| Identification | |
| Name: | 2-Amino-4-methoxybenzoic acid |
| Synonyms: | p-Anisicacid, 2-amino- (6CI,7CI,8CI);4-Methoxyanthranilic acid; |
| CAS: | 4294-95-5 |
| Molecular Formula: | C8H9NO3 |
| Molecular Weight: | 167.16 |
| InChI: | InChI=1/C8H9NO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4H,9H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.303 g/cm3 |
| Refractive index: | 1.603 |
| Specification: |
2-Amino-4-methoxybenzoic acid , with CAS number of 4294-95-5, can be called 2-Amino-4-methoxy-benzoic acid ; 4-Methoxy-2-amino-benzoic acid ; 4-Methoxyanthranilic acid ; 2-Amino-4-methoxybenzoic acid , 99% ; 2-Amine-4-methoxybenzoic acid . 2-Amino-4-methoxybenzoic acid (CAS No.4294-95-5) can be used in organic synthesis. |
| Safety Data | |
 |
|
