Identification |
Name: | 7,9-dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile |
Synonyms: | 7,9-DIOXO-8-AZASPIRO(4.5)DECANE-6,10-DICARBONITRILE, 98%, MIXT. (+/-)/MESO;7,9-dioxo-8-azaspiro(4.5)decane-6,10-dicarbonitri;7,9-Dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile,mixture of (? and meso;7,9-DIOXO-8-AZASPIRO(4.5)DECANE-6,10-DICARBONITRILE) |
CAS: | 42940-56-7 |
Molecular Formula: | C11H11N3O2 |
Molecular Weight: | 217.22394 |
InChI: | InChI=1/C11H11N3O2/c12-5-7-9(15)14-10(16)8(6-13)11(7)3-1-2-4-11/h7-8H,1-4H2,(H,14,15,16) |
Molecular Structure: |
 |
Properties |
Melting Point: | 182-185 °C(lit.)
|
Flash Point: | 291.4°C |
Boiling Point: | 558.2°Cat760mmHg |
Density: | 1.32g/cm3 |
Refractive index: | 1.554 |
Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 291.4°C |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
 |