| Identification | |
| Name: | Ethene,1,2-dichloro-1-fluoro- (9CI) |
| Synonyms: | Ethylene,1,2-dichloro-1-fluoro- (6CI,7CI,8CI); 1,2-Dichloro-1-fluoroethylene;1,2-Dichlorofluoroethene; 1,2-Dichlorofluoroethylene;1-Fluoro-1,2-dichloroethylene; HCFC 1121 |
| CAS: | 430-58-0 |
| EINECS: | 207-065-6 |
| Molecular Formula: | C2H Cl2 F |
| Molecular Weight: | 114.93 |
| InChI: | InChI=1/C2HCl2F/c3-1-2(4)5/h1H/b2-1- |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Flash Point: | °C |
| Boiling Point: | 35.7°Cat760mmHg |
| Density: | 1.381g/cm3 |
| Refractive index: | 1.421 |
| Specification: | Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
