Identification |
Name: | Ethene,1,2-dichloro-1-fluoro- (9CI) |
Synonyms: | Ethylene,1,2-dichloro-1-fluoro- (6CI,7CI,8CI); 1,2-Dichloro-1-fluoroethylene;1,2-Dichlorofluoroethene; 1,2-Dichlorofluoroethylene;1-Fluoro-1,2-dichloroethylene; HCFC 1121 |
CAS: | 430-58-0 |
EINECS: | 207-065-6 |
Molecular Formula: | C2H Cl2 F |
Molecular Weight: | 114.93 |
InChI: | InChI=1/C2HCl2F/c3-1-2(4)5/h1H/b2-1- |
Molecular Structure: |
 |
Properties |
Transport: | 1993 |
Flash Point: | °C |
Boiling Point: | 35.7°Cat760mmHg |
Density: | 1.381g/cm3 |
Refractive index: | 1.421 |
Specification: | Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | °C |
Safety Data |
Hazard Symbols |
F: Flammable
|
|
 |